C27H30F3N7O — CID 171503363
trans-(1R,2R)-2-[[3-[3-[(R)-cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]phenyl]-5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]methylamino]cyclopentan-1-ol (PubChem CID 171503363) has the molecular formula C27H30F3N7O and a molecular weight of 525.58 g/mol. Its IUPAC name is trans-(1R,2R)-2-[[3-[3-[(R)-cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]phenyl]-5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]methylamino]cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-[[3-[3-[(R)-cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]phenyl]-5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]methylamino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 171503363 |
| Molecular Formula | C27H30F3N7O |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | trans-(1R,2R)-2-[[3-[3-[(R)-cyclobutyl-(4-methyl-1,2,4-triazol-3-yl)methyl]phenyl]-5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]methylamino]cyclopentan-1-ol |
| SMILES | Cn1cnnc1[C@@H](c1cccc(-c2n[nH]c3c(CN[C@@H]4CCC[C@H]4O)nc(C(F)(F)F)cc23)c1)C1CCC1 |
| InChI | InChI=1S/C27H30F3N7O/c1-37-14-32-36-26(37)23(15-5-2-6-15)16-7-3-8-17(11-16)24-18-12-22(27(28,29)30)33-20(25(18)35-34-24)13-31-19-9-4-10-21(19)38/h3,7-8,11-12,14-15,19,21,23,31,38H,2,4-6,9-10,13H2,1H3,(H,34,35)/t19-,21-,23-/m1/s1 |
| InChIKey | UADRPTIBPDRLMI-KJXAQDMKSA-N |
| XLogP | 4.71 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |