About 1-[5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]ethanol
1-[5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]ethanol (PubChem CID 171503602) has the molecular formula C9H8F3N3O
and a molecular weight of 231.18 g/mol. Its IUPAC name is 1-[5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]ethanol.
Molecular Properties
| Compound Name | 1-[5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]ethanol |
| PubChem CID | 171503602 |
| Molecular Formula | C9H8F3N3O |
| Molecular Weight | 231.18 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 1-[5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]ethanol |
| SMILES | CC(O)c1nc(C(F)(F)F)cc2cn[nH]c12 |
| InChI | InChI=1S/C9H8F3N3O/c1-4(16)7-8-5(3-13-15-8)2-6(14-7)9(10,11)12/h2-4,16H,1H3,(H,13,15) |
| InChIKey | VHQLODNSXREJOW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]ethanol?
The IUPAC name of 1-[5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]ethanol (CID 171503602) is 1-[5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]ethanol.
What is the SMILES notation for 1-[5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]ethanol?
The canonical SMILES for 1-[5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]ethanol is CC(O)c1nc(C(F)(F)F)cc2cn[nH]c12.
What is the InChIKey of 1-[5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]ethanol?
The InChIKey is VHQLODNSXREJOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F3N3O/c1-4(16)7-8-5(3-13-15-8)2-6(14-7)9(10,11)12/h2-4,16H,1H3,(H,13,15).
What are the key properties of 1-[5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]ethanol?
1-[5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]ethanol has a molecular weight of 231.18 g/mol, XLogP of 2.03, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(trifluoromethyl)-1H-pyrazolo[3,4-c]pyridin-7-yl]ethanol is sourced from PubChem (CID 171503602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).