About (E)-3-(2,2-difluoroethylimino)-2-fluoroprop-1-en-1-amine
(E)-3-(2,2-difluoroethylimino)-2-fluoroprop-1-en-1-amine (PubChem CID 171503795) has the molecular formula C5H7F3N2
and a molecular weight of 152.12 g/mol. Its IUPAC name is (E)-3-(2,2-difluoroethylimino)-2-fluoroprop-1-en-1-amine.
Molecular Properties
| Compound Name | (E)-3-(2,2-difluoroethylimino)-2-fluoroprop-1-en-1-amine |
| PubChem CID | 171503795 |
| Molecular Formula | C5H7F3N2 |
| Molecular Weight | 152.12 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | (E)-3-(2,2-difluoroethylimino)-2-fluoroprop-1-en-1-amine |
| SMILES | N/C=C(F)\C=N\CC(F)F |
| InChI | InChI=1S/C5H7F3N2/c6-4(1-9)2-10-3-5(7)8/h1-2,5H,3,9H2/b4-1+,10-2+ |
| InChIKey | UUBKBJBWBPSVTC-FGNGZXAXSA-N |
| XLogP | 1.09 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.12 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(2,2-difluoroethylimino)-2-fluoroprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(2,2-difluoroethylimino)-2-fluoroprop-1-en-1-amine?
The IUPAC name of (E)-3-(2,2-difluoroethylimino)-2-fluoroprop-1-en-1-amine (CID 171503795) is (E)-3-(2,2-difluoroethylimino)-2-fluoroprop-1-en-1-amine.
What is the SMILES notation for (E)-3-(2,2-difluoroethylimino)-2-fluoroprop-1-en-1-amine?
The canonical SMILES for (E)-3-(2,2-difluoroethylimino)-2-fluoroprop-1-en-1-amine is N/C=C(F)\C=N\CC(F)F.
What is the InChIKey of (E)-3-(2,2-difluoroethylimino)-2-fluoroprop-1-en-1-amine?
The InChIKey is UUBKBJBWBPSVTC-FGNGZXAXSA-N. The full InChI is InChI=1S/C5H7F3N2/c6-4(1-9)2-10-3-5(7)8/h1-2,5H,3,9H2/b4-1+,10-2+.
What are the key properties of (E)-3-(2,2-difluoroethylimino)-2-fluoroprop-1-en-1-amine?
(E)-3-(2,2-difluoroethylimino)-2-fluoroprop-1-en-1-amine has a molecular weight of 152.12 g/mol, XLogP of 1.09, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(2,2-difluoroethylimino)-2-fluoroprop-1-en-1-amine is sourced from PubChem (CID 171503795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).