C19H24N4O4S — CID 171504776
cis-(1R,3S)-N-hydroxy-3-(methanesulfonamido)-N-methyl-1-[(3-pyrimidin-2-ylphenyl)methyl]cyclopentane-1-carboxamide (PubChem CID 171504776) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is cis-(1R,3S)-N-hydroxy-3-(methanesulfonamido)-N-methyl-1-[(3-pyrimidin-2-ylphenyl)methyl]cyclopentane-1-carboxamide.
| Compound Name | cis-(1R,3S)-N-hydroxy-3-(methanesulfonamido)-N-methyl-1-[(3-pyrimidin-2-ylphenyl)methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 171504776 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | cis-(1R,3S)-N-hydroxy-3-(methanesulfonamido)-N-methyl-1-[(3-pyrimidin-2-ylphenyl)methyl]cyclopentane-1-carboxamide |
| SMILES | CN(O)C(=O)[C@@]1(Cc2cccc(-c3ncccn3)c2)CC[C@H](NS(C)(=O)=O)C1 |
| InChI | InChI=1S/C19H24N4O4S/c1-23(25)18(24)19(8-7-16(13-19)22-28(2,26)27)12-14-5-3-6-15(11-14)17-20-9-4-10-21-17/h3-6,9-11,16,22,25H,7-8,12-13H2,1-2H3/t16-,19+/m0/s1 |
| InChIKey | STPHGTHXIFQPLX-QFBILLFUSA-N |
| XLogP | 1.62 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|