C13H27N — CID 171506139
3,5-dimethyl-1,4-di(propan-2-yl)piperidine (PubChem CID 171506139) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is 3,5-dimethyl-1,4-di(propan-2-yl)piperidine.
| Compound Name | 3,5-dimethyl-1,4-di(propan-2-yl)piperidine |
|---|---|
| PubChem CID | 171506139 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 3,5-dimethyl-1,4-di(propan-2-yl)piperidine |
| SMILES | CC(C)C1C(C)CN(C(C)C)CC1C |
| InChI | InChI=1S/C13H27N/c1-9(2)13-11(5)7-14(10(3)4)8-12(13)6/h9-13H,7-8H2,1-6H3 |
| InChIKey | BLOAMQNNVWUKOW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |