About (Z)-2,4-dimethyl-3-(3-methylheptan-3-ylimino)pent-1-en-1-amine
(Z)-2,4-dimethyl-3-(3-methylheptan-3-ylimino)pent-1-en-1-amine (PubChem CID 171506297) has the molecular formula C15H30N2
and a molecular weight of 238.42 g/mol. Its IUPAC name is (Z)-2,4-dimethyl-3-(3-methylheptan-3-ylimino)pent-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-2,4-dimethyl-3-(3-methylheptan-3-ylimino)pent-1-en-1-amine |
| PubChem CID | 171506297 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | (Z)-2,4-dimethyl-3-(3-methylheptan-3-ylimino)pent-1-en-1-amine |
| SMILES | CCCCC(C)(CC)/N=C(C(/C)=C\N)\C(C)C |
| InChI | InChI=1S/C15H30N2/c1-7-9-10-15(6,8-2)17-14(12(3)4)13(5)11-16/h11-12H,7-10,16H2,1-6H3/b13-11-,17-14+ |
| InChIKey | BSOXCVXPBDITOO-YROUWHAASA-N |
| XLogP | 4.30 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,4-dimethyl-3-(3-methylheptan-3-ylimino)pent-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,4-dimethyl-3-(3-methylheptan-3-ylimino)pent-1-en-1-amine?
The IUPAC name of (Z)-2,4-dimethyl-3-(3-methylheptan-3-ylimino)pent-1-en-1-amine (CID 171506297) is (Z)-2,4-dimethyl-3-(3-methylheptan-3-ylimino)pent-1-en-1-amine.
What is the SMILES notation for (Z)-2,4-dimethyl-3-(3-methylheptan-3-ylimino)pent-1-en-1-amine?
The canonical SMILES for (Z)-2,4-dimethyl-3-(3-methylheptan-3-ylimino)pent-1-en-1-amine is CCCCC(C)(CC)/N=C(C(/C)=C\N)\C(C)C.
What is the InChIKey of (Z)-2,4-dimethyl-3-(3-methylheptan-3-ylimino)pent-1-en-1-amine?
The InChIKey is BSOXCVXPBDITOO-YROUWHAASA-N. The full InChI is InChI=1S/C15H30N2/c1-7-9-10-15(6,8-2)17-14(12(3)4)13(5)11-16/h11-12H,7-10,16H2,1-6H3/b13-11-,17-14+.
What are the key properties of (Z)-2,4-dimethyl-3-(3-methylheptan-3-ylimino)pent-1-en-1-amine?
(Z)-2,4-dimethyl-3-(3-methylheptan-3-ylimino)pent-1-en-1-amine has a molecular weight of 238.42 g/mol, XLogP of 4.30, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,4-dimethyl-3-(3-methylheptan-3-ylimino)pent-1-en-1-amine is sourced from PubChem (CID 171506297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).