C16H25N3O3 — CID 171506433
tert-butyl 4-[2-(oxetan-3-yl)pyrazol-3-yl]piperidine-1-carboxylate (PubChem CID 171506433) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is tert-butyl 4-[2-(oxetan-3-yl)pyrazol-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(oxetan-3-yl)pyrazol-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171506433 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | tert-butyl 4-[2-(oxetan-3-yl)pyrazol-3-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccnn2C2COC2)CC1 |
| InChI | InChI=1S/C16H25N3O3/c1-16(2,3)22-15(20)18-8-5-12(6-9-18)14-4-7-17-19(14)13-10-21-11-13/h4,7,12-13H,5-6,8-11H2,1-3H3 |
| InChIKey | VXKXWQDRMGKILU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |