About CID 171506907
CID 171506907 (PubChem CID 171506907) has the molecular formula C32H56ClN5O4SSi3-
and a molecular weight of 726.61 g/mol.
Molecular Properties
| Compound Name | CID 171506907 |
| PubChem CID | 171506907 |
| Molecular Formula | C32H56ClN5O4SSi3- |
| Molecular Weight | 726.61 g/mol |
| Exact Mass | 725.31 |
| IUPAC Name | — |
| SMILES | CC[Si](C#C[C@@]1(CO[Si-](O[Si](O)(C(C)C)C(C)C)(C(C)C)C(C)C)CCC(n2cnc3c(Cl)nc(NC(C)=O)nc32)S1)(CC)CC |
| InChI | InChI=1S/C32H56ClN5O4SSi3/c1-13-44(14-2,15-3)19-18-32(20-41-46(24(8)9,25(10)11)42-45(40,22(4)5)23(6)7)17-16-27(43-32)38-21-34-28-29(33)36-31(35-26(12)39)37-30(28)38/h21-25,27,40H,13-17,20H2,1-12H3,(H,35,36,37,39)/q-1/t27?,32-/m1/s1 |
| InChIKey | VXKTXAGWDKOMKX-ZGKSLXBNSA-N |
| XLogP | 8.80 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 726.61 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 171506907 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171506907?
The IUPAC name of CID 171506907 (CID 171506907) is not available.
What is the SMILES notation for CID 171506907?
The canonical SMILES for CID 171506907 is CC[Si](C#C[C@@]1(CO[Si-](O[Si](O)(C(C)C)C(C)C)(C(C)C)C(C)C)CCC(n2cnc3c(Cl)nc(NC(C)=O)nc32)S1)(CC)CC.
What is the InChIKey of CID 171506907?
The InChIKey is VXKTXAGWDKOMKX-ZGKSLXBNSA-N. The full InChI is InChI=1S/C32H56ClN5O4SSi3/c1-13-44(14-2,15-3)19-18-32(20-41-46(24(8)9,25(10)11)42-45(40,22(4)5)23(6)7)17-16-27(43-32)38-21-34-28-29(33)36-31(35-26(12)39)37-30(28)38/h21-25,27,40H,13-17,20H2,1-12H3,(H,35,36,37,39)/q-1/t27?,32-/m1/s1.
What are the key properties of CID 171506907?
CID 171506907 has a molecular weight of 726.61 g/mol, XLogP of 8.80, 14 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171506907 is sourced from PubChem (CID 171506907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).