C18H9B3ClF7N4O4 — CID 171507118
CID 171507118 (PubChem CID 171507118) has the molecular formula C18H9B3ClF7N4O4 and a molecular weight of 546.17 g/mol.
| Compound Name | CID 171507118 |
|---|---|
| PubChem CID | 171507118 |
| Molecular Formula | C18H9B3ClF7N4O4 |
| Molecular Weight | 546.17 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | — |
| SMILES | [B]C1(O)NC(=O)N(c2cc(C(F)(F)F)cc(C(F)(F)F)c2OC(=O)N(C)c2ccc(F)c(Cl)n2)C1([B])[B] |
| InChI | InChI=1S/C18H9B3ClF7N4O4/c1-32(10-3-2-8(23)12(22)30-10)14(35)37-11-7(16(27,28)29)4-6(15(24,25)26)5-9(11)33-13(34)31-18(21,36)17(33,19)20/h2-5,36H,1H3,(H,31,34) |
| InChIKey | XWZKQFMAEHHORF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.17 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|