About CID 171507118
CID 171507118 (PubChem CID 171507118) has the molecular formula C18H9B3ClF7N4O4
and a molecular weight of 546.17 g/mol.
Molecular Properties
| Compound Name | CID 171507118 |
| PubChem CID | 171507118 |
| Molecular Formula | C18H9B3ClF7N4O4 |
| Molecular Weight | 546.17 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | — |
| SMILES | [B]C1(O)NC(=O)N(c2cc(C(F)(F)F)cc(C(F)(F)F)c2OC(=O)N(C)c2ccc(F)c(Cl)n2)C1([B])[B] |
| InChI | InChI=1S/C18H9B3ClF7N4O4/c1-32(10-3-2-8(23)12(22)30-10)14(35)37-11-7(16(27,28)29)4-6(15(24,25)26)5-9(11)33-13(34)31-18(21,36)17(33,19)20/h2-5,36H,1H3,(H,31,34) |
| InChIKey | XWZKQFMAEHHORF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 546.17 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 171507118 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171507118?
The IUPAC name of CID 171507118 (CID 171507118) is not available.
What is the SMILES notation for CID 171507118?
The canonical SMILES for CID 171507118 is [B]C1(O)NC(=O)N(c2cc(C(F)(F)F)cc(C(F)(F)F)c2OC(=O)N(C)c2ccc(F)c(Cl)n2)C1([B])[B].
What is the InChIKey of CID 171507118?
The InChIKey is XWZKQFMAEHHORF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H9B3ClF7N4O4/c1-32(10-3-2-8(23)12(22)30-10)14(35)37-11-7(16(27,28)29)4-6(15(24,25)26)5-9(11)33-13(34)31-18(21,36)17(33,19)20/h2-5,36H,1H3,(H,31,34).
What are the key properties of CID 171507118?
CID 171507118 has a molecular weight of 546.17 g/mol, XLogP of 2.88, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171507118 is sourced from PubChem (CID 171507118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).