C29H34F7N5O8S — CID 171507385
[2-[3-[2-[[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetyl]amino]sulfanyloxyethyl]-2-oxoimidazolidin-1-yl]-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate (PubChem CID 171507385) has the molecular formula C29H34F7N5O8S and a molecular weight of 745.67 g/mol. Its IUPAC name is [2-[3-[2-[[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetyl]amino]sulfanyloxyethyl]-2-oxoimidazolidin-1-yl]-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate.
| Compound Name | [2-[3-[2-[[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetyl]amino]sulfanyloxyethyl]-2-oxoimidazolidin-1-yl]-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 171507385 |
| Molecular Formula | C29H34F7N5O8S |
| Molecular Weight | 745.67 g/mol |
| Exact Mass | 745.20 |
| IUPAC Name | [2-[3-[2-[[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]acetyl]amino]sulfanyloxyethyl]-2-oxoimidazolidin-1-yl]-4,6-bis(trifluoromethyl)phenyl] N-(4-fluorophenyl)-N-methylcarbamate |
| SMILES | CN(C(=O)Oc1c(N2CCN(CCOSNC(=O)COCCOCCOCCN)C2=O)cc(C(F)(F)F)cc1C(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C29H34F7N5O8S/c1-39(21-4-2-20(30)3-5-21)27(44)49-25-22(29(34,35)36)16-19(28(31,32)33)17-23(25)41-8-7-40(26(41)43)9-11-48-50-38-24(42)18-47-15-14-46-13-12-45-10-6-37/h2-5,16-17H,6-15,18,37H2,1H3,(H,38,42) |
| InChIKey | LALRBRQGPHCIGJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 145.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.67 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|