C16H34N2OS2 — CID 171508571
N-[4-[(4-amino-2,4-dimethylpentan-2-yl)disulfanyl]-2,4-dimethylpentan-2-yl]acetamide (PubChem CID 171508571) has the molecular formula C16H34N2OS2 and a molecular weight of 334.60 g/mol. Its IUPAC name is N-[4-[(4-amino-2,4-dimethylpentan-2-yl)disulfanyl]-2,4-dimethylpentan-2-yl]acetamide.
| Compound Name | N-[4-[(4-amino-2,4-dimethylpentan-2-yl)disulfanyl]-2,4-dimethylpentan-2-yl]acetamide |
|---|---|
| PubChem CID | 171508571 |
| Molecular Formula | C16H34N2OS2 |
| Molecular Weight | 334.60 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | N-[4-[(4-amino-2,4-dimethylpentan-2-yl)disulfanyl]-2,4-dimethylpentan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)(C)CC(C)(C)SSC(C)(C)CC(C)(C)N |
| InChI | InChI=1S/C16H34N2OS2/c1-12(19)18-14(4,5)11-16(8,9)21-20-15(6,7)10-13(2,3)17/h10-11,17H2,1-9H3,(H,18,19) |
| InChIKey | CRQPBOCEARIQJV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|