C21H25N3O5 — CID 171508996
ethyl 13-(3-methoxypropoxy)-4-oxo-7,10,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),5,11,13,15-pentaene-5-carboxylate (PubChem CID 171508996) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is ethyl 13-(3-methoxypropoxy)-4-oxo-7,10,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),5,11,13,15-pentaene-5-carboxylate.
| Compound Name | ethyl 13-(3-methoxypropoxy)-4-oxo-7,10,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),5,11,13,15-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 171508996 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | ethyl 13-(3-methoxypropoxy)-4-oxo-7,10,11-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(17),5,11,13,15-pentaene-5-carboxylate |
| SMILES | CCOC(=O)C1=CN2CCn3nc4c(OCCCOC)cccc4c3C2CC1=O |
| InChI | InChI=1S/C21H25N3O5/c1-3-28-21(26)15-13-23-8-9-24-20(16(23)12-17(15)25)14-6-4-7-18(19(14)22-24)29-11-5-10-27-2/h4,6-7,13,16H,3,5,8-12H2,1-2H3 |
| InChIKey | OIUJFQXXSFUCOV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|