C17H23N7 — CID 171509547
2-N-[(3-ethyl-2-methyl-1H-indol-5-yl)methyl]-4-N,6-N-dimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 171509547) has the molecular formula C17H23N7 and a molecular weight of 325.42 g/mol. Its IUPAC name is 2-N-[(3-ethyl-2-methyl-1H-indol-5-yl)methyl]-4-N,6-N-dimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(3-ethyl-2-methyl-1H-indol-5-yl)methyl]-4-N,6-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 171509547 |
| Molecular Formula | C17H23N7 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2-N-[(3-ethyl-2-methyl-1H-indol-5-yl)methyl]-4-N,6-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCc1c(C)[nH]c2ccc(CNc3nc(NC)nc(NC)n3)cc12 |
| InChI | InChI=1S/C17H23N7/c1-5-12-10(2)21-14-7-6-11(8-13(12)14)9-20-17-23-15(18-3)22-16(19-4)24-17/h6-8,21H,5,9H2,1-4H3,(H3,18,19,20,22,23,24) |
| InChIKey | UWUCFWNZERTPDA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|