C16H15Cl2NO2 — CID 17151016
3,5-dichloro-N-(2-propan-2-yloxyphenyl)benzamide (PubChem CID 17151016) has the molecular formula C16H15Cl2NO2 and a molecular weight of 324.21 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-propan-2-yloxyphenyl)benzamide.
| Compound Name | 3,5-dichloro-N-(2-propan-2-yloxyphenyl)benzamide |
|---|---|
| PubChem CID | 17151016 |
| Molecular Formula | C16H15Cl2NO2 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 3,5-dichloro-N-(2-propan-2-yloxyphenyl)benzamide |
| SMILES | CC(C)Oc1ccccc1NC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2NO2/c1-10(2)21-15-6-4-3-5-14(15)19-16(20)11-7-12(17)9-13(18)8-11/h3-10H,1-2H3,(H,19,20) |
| InChIKey | SCLZEZURWFGHTP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |