About 3-(2,5-dihydro-1H-pyrrol-3-yl)-1,2-benzothiazole
3-(2,5-dihydro-1H-pyrrol-3-yl)-1,2-benzothiazole (PubChem CID 171510226) has the molecular formula C11H10N2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is 3-(2,5-dihydro-1H-pyrrol-3-yl)-1,2-benzothiazole.
Molecular Properties
| Compound Name | 3-(2,5-dihydro-1H-pyrrol-3-yl)-1,2-benzothiazole |
| PubChem CID | 171510226 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 3-(2,5-dihydro-1H-pyrrol-3-yl)-1,2-benzothiazole |
| SMILES | C1=C(c2nsc3ccccc23)CNC1 |
| InChI | InChI=1S/C11H10N2S/c1-2-4-10-9(3-1)11(13-14-10)8-5-6-12-7-8/h1-5,12H,6-7H2 |
| InChIKey | JDPSVHBYHXLMNU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,5-dihydro-1H-pyrrol-3-yl)-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dihydro-1H-pyrrol-3-yl)-1,2-benzothiazole?
The IUPAC name of 3-(2,5-dihydro-1H-pyrrol-3-yl)-1,2-benzothiazole (CID 171510226) is 3-(2,5-dihydro-1H-pyrrol-3-yl)-1,2-benzothiazole.
What is the SMILES notation for 3-(2,5-dihydro-1H-pyrrol-3-yl)-1,2-benzothiazole?
The canonical SMILES for 3-(2,5-dihydro-1H-pyrrol-3-yl)-1,2-benzothiazole is C1=C(c2nsc3ccccc23)CNC1.
What is the InChIKey of 3-(2,5-dihydro-1H-pyrrol-3-yl)-1,2-benzothiazole?
The InChIKey is JDPSVHBYHXLMNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2S/c1-2-4-10-9(3-1)11(13-14-10)8-5-6-12-7-8/h1-5,12H,6-7H2.
What are the key properties of 3-(2,5-dihydro-1H-pyrrol-3-yl)-1,2-benzothiazole?
3-(2,5-dihydro-1H-pyrrol-3-yl)-1,2-benzothiazole has a molecular weight of 202.28 g/mol, XLogP of 2.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dihydro-1H-pyrrol-3-yl)-1,2-benzothiazole is sourced from PubChem (CID 171510226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).