C7H9N3 — CID 171511525
2,3,8-triazatricyclo[5.2.1.02,6]deca-3,5-diene (PubChem CID 171511525) has the molecular formula C7H9N3 and a molecular weight of 135.17 g/mol. Its IUPAC name is 2,3,8-triazatricyclo[5.2.1.02,6]deca-3,5-diene.
| Compound Name | 2,3,8-triazatricyclo[5.2.1.02,6]deca-3,5-diene |
|---|---|
| PubChem CID | 171511525 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 2,3,8-triazatricyclo[5.2.1.02,6]deca-3,5-diene |
| SMILES | c1cc2n(n1)C1CNC2C1 |
| InChI | InChI=1S/C7H9N3/c1-2-9-10-5-3-6(7(1)10)8-4-5/h1-2,5-6,8H,3-4H2 |
| InChIKey | BGMONVBNIFHIDP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |