C23H21ClFN7O2 — CID 171511535
(3R)-N-(4-chloro-2-fluoro-5-pyrrolo[2,1-f][1,2,4]triazin-2-ylphenyl)-3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)-6-azabicyclo[3.1.1]heptane-6-carboxamide (PubChem CID 171511535) has the molecular formula C23H21ClFN7O2 and a molecular weight of 481.92 g/mol. Its IUPAC name is (3R)-N-(4-chloro-2-fluoro-5-pyrrolo[2,1-f][1,2,4]triazin-2-ylphenyl)-3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)-6-azabicyclo[3.1.1]heptane-6-carboxamide.
| Compound Name | (3R)-N-(4-chloro-2-fluoro-5-pyrrolo[2,1-f][1,2,4]triazin-2-ylphenyl)-3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)-6-azabicyclo[3.1.1]heptane-6-carboxamide |
|---|---|
| PubChem CID | 171511535 |
| Molecular Formula | C23H21ClFN7O2 |
| Molecular Weight | 481.92 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | (3R)-N-(4-chloro-2-fluoro-5-pyrrolo[2,1-f][1,2,4]triazin-2-ylphenyl)-3-methyl-1-(5-methyl-1,3,4-oxadiazol-2-yl)-6-azabicyclo[3.1.1]heptane-6-carboxamide |
| SMILES | Cc1nnc(C23CC(C[C@@H](C)C2)N3C(=O)Nc2cc(-c3ncc4cccn4n3)c(Cl)cc2F)o1 |
| InChI | InChI=1S/C23H21ClFN7O2/c1-12-6-15-10-23(9-12,21-29-28-13(2)34-21)32(15)22(33)27-19-7-16(17(24)8-18(19)25)20-26-11-14-4-3-5-31(14)30-20/h3-5,7-8,11-12,15H,6,9-10H2,1-2H3,(H,27,33)/t12-,15?,23?/m1/s1 |
| InChIKey | ANCPHXKYMSHUAY-XXKDKMCJSA-N |
| XLogP | 4.81 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.92 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |