C24H30N6O2 — CID 171511694
ethanimidoyl (6R)-6-methyl-1-[(4-methyl-3-pyrrolo[1,2-a]pyrimidin-3-ylphenyl)carbamoyl]piperidine-2-carboximidate;molecular hydrogen (PubChem CID 171511694) has the molecular formula C24H30N6O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is ethanimidoyl (6R)-6-methyl-1-[(4-methyl-3-pyrrolo[1,2-a]pyrimidin-3-ylphenyl)carbamoyl]piperidine-2-carboximidate;molecular hydrogen.
| Compound Name | ethanimidoyl (6R)-6-methyl-1-[(4-methyl-3-pyrrolo[1,2-a]pyrimidin-3-ylphenyl)carbamoyl]piperidine-2-carboximidate;molecular hydrogen |
|---|---|
| PubChem CID | 171511694 |
| Molecular Formula | C24H30N6O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | ethanimidoyl (6R)-6-methyl-1-[(4-methyl-3-pyrrolo[1,2-a]pyrimidin-3-ylphenyl)carbamoyl]piperidine-2-carboximidate;molecular hydrogen |
| SMILES | [H]/N=C(/C)O/C(=N\[H])C1CCC[C@@H](C)N1C(=O)Nc1ccc(C)c(-c2cnc3cccn3c2)c1.[H][H] |
| InChI | InChI=1S/C24H28N6O2.H2/c1-15-9-10-19(12-20(15)18-13-27-22-8-5-11-29(22)14-18)28-24(31)30-16(2)6-4-7-21(30)23(26)32-17(3)25;/h5,8-14,16,21,25-26H,4,6-7H2,1-3H3,(H,28,31);1H/b25-17-,26-23-;/t16-,21?;/m1./s1 |
| InChIKey | LNJLDXBJLLDVRL-MSBHVDCZSA-N |
| XLogP | 5.32 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|