C23H24N8O — CID 171511726
(1S,5R)-N-(4-methyl-3-pyrrolo[2,1-f][1,2,4]triazin-2-ylphenyl)-1-(2-methyl-1,2,4-triazol-3-yl)-6-azabicyclo[3.1.1]heptane-6-carboxamide (PubChem CID 171511726) has the molecular formula C23H24N8O and a molecular weight of 428.50 g/mol. Its IUPAC name is (1S,5R)-N-(4-methyl-3-pyrrolo[2,1-f][1,2,4]triazin-2-ylphenyl)-1-(2-methyl-1,2,4-triazol-3-yl)-6-azabicyclo[3.1.1]heptane-6-carboxamide.
| Compound Name | (1S,5R)-N-(4-methyl-3-pyrrolo[2,1-f][1,2,4]triazin-2-ylphenyl)-1-(2-methyl-1,2,4-triazol-3-yl)-6-azabicyclo[3.1.1]heptane-6-carboxamide |
|---|---|
| PubChem CID | 171511726 |
| Molecular Formula | C23H24N8O |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (1S,5R)-N-(4-methyl-3-pyrrolo[2,1-f][1,2,4]triazin-2-ylphenyl)-1-(2-methyl-1,2,4-triazol-3-yl)-6-azabicyclo[3.1.1]heptane-6-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2[C@@H]3CCC[C@@]2(c2ncnn2C)C3)cc1-c1ncc2cccn2n1 |
| InChI | InChI=1S/C23H24N8O/c1-15-7-8-16(11-19(15)20-24-13-18-6-4-10-30(18)28-20)27-22(32)31-17-5-3-9-23(31,12-17)21-25-14-26-29(21)2/h4,6-8,10-11,13-14,17H,3,5,9,12H2,1-2H3,(H,27,32)/t17-,23+/m1/s1 |
| InChIKey | LLGLTCZCEOZQBC-HXOBKFHXSA-N |
| XLogP | 3.52 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |