C20H29N3O5 — CID 171512735
tert-butyl 2,2-dimethyl-5-oxo-4-[(2-phenylmethoxycarbonylhydrazinyl)methyl]pyrrolidine-1-carboxylate (PubChem CID 171512735) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-5-oxo-4-[(2-phenylmethoxycarbonylhydrazinyl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2,2-dimethyl-5-oxo-4-[(2-phenylmethoxycarbonylhydrazinyl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 171512735 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | tert-butyl 2,2-dimethyl-5-oxo-4-[(2-phenylmethoxycarbonylhydrazinyl)methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C(CNNC(=O)OCc2ccccc2)CC1(C)C |
| InChI | InChI=1S/C20H29N3O5/c1-19(2,3)28-18(26)23-16(24)15(11-20(23,4)5)12-21-22-17(25)27-13-14-9-7-6-8-10-14/h6-10,15,21H,11-13H2,1-5H3,(H,22,25) |
| InChIKey | OUDPIEGMZRBBMO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|