C18H18ClFN2O2S — CID 171513519
(2-chloro-4-fluorophenyl)-[4-(2-methoxy-5-sulfanylphenyl)piperazin-1-yl]methanone (PubChem CID 171513519) has the molecular formula C18H18ClFN2O2S and a molecular weight of 380.87 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)-[4-(2-methoxy-5-sulfanylphenyl)piperazin-1-yl]methanone.
| Compound Name | (2-chloro-4-fluorophenyl)-[4-(2-methoxy-5-sulfanylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 171513519 |
| Molecular Formula | C18H18ClFN2O2S |
| Molecular Weight | 380.87 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (2-chloro-4-fluorophenyl)-[4-(2-methoxy-5-sulfanylphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(S)cc1N1CCN(C(=O)c2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C18H18ClFN2O2S/c1-24-17-5-3-13(25)11-16(17)21-6-8-22(9-7-21)18(23)14-4-2-12(20)10-15(14)19/h2-5,10-11,25H,6-9H2,1H3 |
| InChIKey | WJLCNBHWCILNTM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 32.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.87 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|