C18H21BrN4O4 — CID 171513631
tert-butyl 8-bromo-4-(3,6-dihydro-2H-pyran-4-yl)-7-oxo-1,3,5,6-tetrazatricyclo[7.3.0.02,6]dodeca-2,4,8-triene-12-carboxylate (PubChem CID 171513631) has the molecular formula C18H21BrN4O4 and a molecular weight of 437.29 g/mol. Its IUPAC name is tert-butyl 8-bromo-4-(3,6-dihydro-2H-pyran-4-yl)-7-oxo-1,3,5,6-tetrazatricyclo[7.3.0.02,6]dodeca-2,4,8-triene-12-carboxylate.
| Compound Name | tert-butyl 8-bromo-4-(3,6-dihydro-2H-pyran-4-yl)-7-oxo-1,3,5,6-tetrazatricyclo[7.3.0.02,6]dodeca-2,4,8-triene-12-carboxylate |
|---|---|
| PubChem CID | 171513631 |
| Molecular Formula | C18H21BrN4O4 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | tert-butyl 8-bromo-4-(3,6-dihydro-2H-pyran-4-yl)-7-oxo-1,3,5,6-tetrazatricyclo[7.3.0.02,6]dodeca-2,4,8-triene-12-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCc2c(Br)c(=O)n3nc(C4=CCOCC4)nc3n21 |
| InChI | InChI=1S/C18H21BrN4O4/c1-18(2,3)27-16(25)12-5-4-11-13(19)15(24)23-17(22(11)12)20-14(21-23)10-6-8-26-9-7-10/h6,12H,4-5,7-9H2,1-3H3 |
| InChIKey | KFNFXQJQZJDUPW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |