About 7-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-phenylimidazo[4,5-c]quinolin-4-one
7-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-phenylimidazo[4,5-c]quinolin-4-one (PubChem CID 171514424) has the molecular formula C26H22ClN3O3
and a molecular weight of 459.93 g/mol. Its IUPAC name is 7-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-phenylimidazo[4,5-c]quinolin-4-one.
Molecular Properties
| Compound Name | 7-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-phenylimidazo[4,5-c]quinolin-4-one |
| PubChem CID | 171514424 |
| Molecular Formula | C26H22ClN3O3 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 7-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-phenylimidazo[4,5-c]quinolin-4-one |
| SMILES | COc1ccc(Cc2nc3c(=O)n(-c4ccccc4)c4cc(Cl)ccc4c3n2C)cc1OC |
| InChI | InChI=1S/C26H22ClN3O3/c1-29-23(14-16-9-12-21(32-2)22(13-16)33-3)28-24-25(29)19-11-10-17(27)15-20(19)30(26(24)31)18-7-5-4-6-8-18/h4-13,15H,14H2,1-3H3 |
| InChIKey | GMFJIEQSVCFSQD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-phenylimidazo[4,5-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-phenylimidazo[4,5-c]quinolin-4-one?
The IUPAC name of 7-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-phenylimidazo[4,5-c]quinolin-4-one (CID 171514424) is 7-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-phenylimidazo[4,5-c]quinolin-4-one.
What is the SMILES notation for 7-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-phenylimidazo[4,5-c]quinolin-4-one?
The canonical SMILES for 7-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-phenylimidazo[4,5-c]quinolin-4-one is COc1ccc(Cc2nc3c(=O)n(-c4ccccc4)c4cc(Cl)ccc4c3n2C)cc1OC.
What is the InChIKey of 7-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-phenylimidazo[4,5-c]quinolin-4-one?
The InChIKey is GMFJIEQSVCFSQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22ClN3O3/c1-29-23(14-16-9-12-21(32-2)22(13-16)33-3)28-24-25(29)19-11-10-17(27)15-20(19)30(26(24)31)18-7-5-4-6-8-18/h4-13,15H,14H2,1-3H3.
What are the key properties of 7-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-phenylimidazo[4,5-c]quinolin-4-one?
7-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-phenylimidazo[4,5-c]quinolin-4-one has a molecular weight of 459.93 g/mol, XLogP of 5.14, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-phenylimidazo[4,5-c]quinolin-4-one is sourced from PubChem (CID 171514424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).