About 7-chloro-2-(4-methoxyphenyl)-1-methyl-5-(2-methylphenyl)imidazo[4,5-c]quinolin-4-one
7-chloro-2-(4-methoxyphenyl)-1-methyl-5-(2-methylphenyl)imidazo[4,5-c]quinolin-4-one (PubChem CID 171514436) has the molecular formula C25H20ClN3O2
and a molecular weight of 429.91 g/mol. Its IUPAC name is 7-chloro-2-(4-methoxyphenyl)-1-methyl-5-(2-methylphenyl)imidazo[4,5-c]quinolin-4-one.
Molecular Properties
| Compound Name | 7-chloro-2-(4-methoxyphenyl)-1-methyl-5-(2-methylphenyl)imidazo[4,5-c]quinolin-4-one |
| PubChem CID | 171514436 |
| Molecular Formula | C25H20ClN3O2 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 7-chloro-2-(4-methoxyphenyl)-1-methyl-5-(2-methylphenyl)imidazo[4,5-c]quinolin-4-one |
| SMILES | COc1ccc(-c2nc3c(=O)n(-c4ccccc4C)c4cc(Cl)ccc4c3n2C)cc1 |
| InChI | InChI=1S/C25H20ClN3O2/c1-15-6-4-5-7-20(15)29-21-14-17(26)10-13-19(21)23-22(25(29)30)27-24(28(23)2)16-8-11-18(31-3)12-9-16/h4-14H,1-3H3 |
| InChIKey | JUKHYFXDPJSPLT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-chloro-2-(4-methoxyphenyl)-1-methyl-5-(2-methylphenyl)imidazo[4,5-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-(4-methoxyphenyl)-1-methyl-5-(2-methylphenyl)imidazo[4,5-c]quinolin-4-one?
The IUPAC name of 7-chloro-2-(4-methoxyphenyl)-1-methyl-5-(2-methylphenyl)imidazo[4,5-c]quinolin-4-one (CID 171514436) is 7-chloro-2-(4-methoxyphenyl)-1-methyl-5-(2-methylphenyl)imidazo[4,5-c]quinolin-4-one.
What is the SMILES notation for 7-chloro-2-(4-methoxyphenyl)-1-methyl-5-(2-methylphenyl)imidazo[4,5-c]quinolin-4-one?
The canonical SMILES for 7-chloro-2-(4-methoxyphenyl)-1-methyl-5-(2-methylphenyl)imidazo[4,5-c]quinolin-4-one is COc1ccc(-c2nc3c(=O)n(-c4ccccc4C)c4cc(Cl)ccc4c3n2C)cc1.
What is the InChIKey of 7-chloro-2-(4-methoxyphenyl)-1-methyl-5-(2-methylphenyl)imidazo[4,5-c]quinolin-4-one?
The InChIKey is JUKHYFXDPJSPLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20ClN3O2/c1-15-6-4-5-7-20(15)29-21-14-17(26)10-13-19(21)23-22(25(29)30)27-24(28(23)2)16-8-11-18(31-3)12-9-16/h4-14H,1-3H3.
What are the key properties of 7-chloro-2-(4-methoxyphenyl)-1-methyl-5-(2-methylphenyl)imidazo[4,5-c]quinolin-4-one?
7-chloro-2-(4-methoxyphenyl)-1-methyl-5-(2-methylphenyl)imidazo[4,5-c]quinolin-4-one has a molecular weight of 429.91 g/mol, XLogP of 5.51, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-(4-methoxyphenyl)-1-methyl-5-(2-methylphenyl)imidazo[4,5-c]quinolin-4-one is sourced from PubChem (CID 171514436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).