About 3-fluoro-N,6-dimethyl-2-oxo-1H-pyridine-4-carboxamide
3-fluoro-N,6-dimethyl-2-oxo-1H-pyridine-4-carboxamide (PubChem CID 171516278) has the molecular formula C8H9FN2O2
and a molecular weight of 184.17 g/mol. Its IUPAC name is 3-fluoro-N,6-dimethyl-2-oxo-1H-pyridine-4-carboxamide.
Molecular Properties
| Compound Name | 3-fluoro-N,6-dimethyl-2-oxo-1H-pyridine-4-carboxamide |
| PubChem CID | 171516278 |
| Molecular Formula | C8H9FN2O2 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 3-fluoro-N,6-dimethyl-2-oxo-1H-pyridine-4-carboxamide |
| SMILES | CNC(=O)c1cc(C)[nH]c(=O)c1F |
| InChI | InChI=1S/C8H9FN2O2/c1-4-3-5(7(12)10-2)6(9)8(13)11-4/h3H,1-2H3,(H,10,12)(H,11,13) |
| InChIKey | QAYDIFMHLNNDCJ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-fluoro-N,6-dimethyl-2-oxo-1H-pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N,6-dimethyl-2-oxo-1H-pyridine-4-carboxamide?
The IUPAC name of 3-fluoro-N,6-dimethyl-2-oxo-1H-pyridine-4-carboxamide (CID 171516278) is 3-fluoro-N,6-dimethyl-2-oxo-1H-pyridine-4-carboxamide.
What is the SMILES notation for 3-fluoro-N,6-dimethyl-2-oxo-1H-pyridine-4-carboxamide?
The canonical SMILES for 3-fluoro-N,6-dimethyl-2-oxo-1H-pyridine-4-carboxamide is CNC(=O)c1cc(C)[nH]c(=O)c1F.
What is the InChIKey of 3-fluoro-N,6-dimethyl-2-oxo-1H-pyridine-4-carboxamide?
The InChIKey is QAYDIFMHLNNDCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN2O2/c1-4-3-5(7(12)10-2)6(9)8(13)11-4/h3H,1-2H3,(H,10,12)(H,11,13).
What are the key properties of 3-fluoro-N,6-dimethyl-2-oxo-1H-pyridine-4-carboxamide?
3-fluoro-N,6-dimethyl-2-oxo-1H-pyridine-4-carboxamide has a molecular weight of 184.17 g/mol, XLogP of 0.18, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N,6-dimethyl-2-oxo-1H-pyridine-4-carboxamide is sourced from PubChem (CID 171516278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).