C8H14F2N2O — CID 171516608
N-(difluoromethyl)-N,1-dimethylpyrrolidine-3-carboxamide (PubChem CID 171516608) has the molecular formula C8H14F2N2O and a molecular weight of 192.21 g/mol. Its IUPAC name is N-(difluoromethyl)-N,1-dimethylpyrrolidine-3-carboxamide.
| Compound Name | N-(difluoromethyl)-N,1-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 171516608 |
| Molecular Formula | C8H14F2N2O |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | N-(difluoromethyl)-N,1-dimethylpyrrolidine-3-carboxamide |
| SMILES | CN1CCC(C(=O)N(C)C(F)F)C1 |
| InChI | InChI=1S/C8H14F2N2O/c1-11-4-3-6(5-11)7(13)12(2)8(9)10/h6,8H,3-5H2,1-2H3 |
| InChIKey | SFJODFXRUGHZRG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|