C39H58N4O2S — CID 171516962
1-[4-[2-[(2Z,4Z)-5,6-dimethylocta-2,4-dien-4-yl]-3-(2,2-dimethyl-5-oxohexyl)-1-ethylindol-5-yl]-1,3-thiazol-2-yl]-7-hydrazinyl-4-methylheptan-3-one (PubChem CID 171516962) has the molecular formula C39H58N4O2S and a molecular weight of 646.99 g/mol. Its IUPAC name is 1-[4-[2-[(2Z,4Z)-5,6-dimethylocta-2,4-dien-4-yl]-3-(2,2-dimethyl-5-oxohexyl)-1-ethylindol-5-yl]-1,3-thiazol-2-yl]-7-hydrazinyl-4-methylheptan-3-one.
| Compound Name | 1-[4-[2-[(2Z,4Z)-5,6-dimethylocta-2,4-dien-4-yl]-3-(2,2-dimethyl-5-oxohexyl)-1-ethylindol-5-yl]-1,3-thiazol-2-yl]-7-hydrazinyl-4-methylheptan-3-one |
|---|---|
| PubChem CID | 171516962 |
| Molecular Formula | C39H58N4O2S |
| Molecular Weight | 646.99 g/mol |
| Exact Mass | 646.43 |
| IUPAC Name | 1-[4-[2-[(2Z,4Z)-5,6-dimethylocta-2,4-dien-4-yl]-3-(2,2-dimethyl-5-oxohexyl)-1-ethylindol-5-yl]-1,3-thiazol-2-yl]-7-hydrazinyl-4-methylheptan-3-one |
| SMILES | C/C=C\C(=C(/C)C(C)CC)c1c(CC(C)(C)CCC(C)=O)c2cc(-c3csc(CCC(=O)C(C)CCCNN)n3)ccc2n1CC |
| InChI | InChI=1S/C39H58N4O2S/c1-10-14-31(29(7)26(4)11-2)38-33(24-39(8,9)21-20-28(6)44)32-23-30(16-17-35(32)43(38)12-3)34-25-46-37(42-34)19-18-36(45)27(5)15-13-22-41-40/h10,14,16-17,23,25-27,41H,11-13,15,18-22,24,40H2,1-9H3/b14-10-,31-29- |
| InChIKey | KSJBKSYPDWEBCB-LLDHFRKPSA-N |
| XLogP | 9.50 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.99 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|