C19H24N2O2 — CID 17151749
1-(2,5-dimethylphenyl)-5-oxo-N,N-bis(prop-2-enyl)pyrrolidine-3-carboxamide (PubChem CID 17151749) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-5-oxo-N,N-bis(prop-2-enyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(2,5-dimethylphenyl)-5-oxo-N,N-bis(prop-2-enyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17151749 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-5-oxo-N,N-bis(prop-2-enyl)pyrrolidine-3-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)C1CC(=O)N(c2cc(C)ccc2C)C1 |
| InChI | InChI=1S/C19H24N2O2/c1-5-9-20(10-6-2)19(23)16-12-18(22)21(13-16)17-11-14(3)7-8-15(17)4/h5-8,11,16H,1-2,9-10,12-13H2,3-4H3 |
| InChIKey | IXUPZCFFZFACOT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|