About N-(1H-imidazol-5-ylmethyl)-N-(trimethyl-λ4-sulfanyl)acetamide
N-(1H-imidazol-5-ylmethyl)-N-(trimethyl-λ4-sulfanyl)acetamide (PubChem CID 171517726) has the molecular formula C9H17N3OS
and a molecular weight of 215.32 g/mol. Its IUPAC name is N-(1H-imidazol-5-ylmethyl)-N-(trimethyl-λ4-sulfanyl)acetamide.
Molecular Properties
| Compound Name | N-(1H-imidazol-5-ylmethyl)-N-(trimethyl-λ4-sulfanyl)acetamide |
| PubChem CID | 171517726 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | N-(1H-imidazol-5-ylmethyl)-N-(trimethyl-λ4-sulfanyl)acetamide |
| SMILES | CC(=O)N(Cc1cnc[nH]1)S(C)(C)C |
| InChI | InChI=1S/C9H17N3OS/c1-8(13)12(14(2,3)4)6-9-5-10-7-11-9/h5,7H,6H2,1-4H3,(H,10,11) |
| InChIKey | LLGJUKFSTUMOQC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1H-imidazol-5-ylmethyl)-N-(trimethyl-λ4-sulfanyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-imidazol-5-ylmethyl)-N-(trimethyl-λ4-sulfanyl)acetamide?
The IUPAC name of N-(1H-imidazol-5-ylmethyl)-N-(trimethyl-λ4-sulfanyl)acetamide (CID 171517726) is N-(1H-imidazol-5-ylmethyl)-N-(trimethyl-λ4-sulfanyl)acetamide.
What is the SMILES notation for N-(1H-imidazol-5-ylmethyl)-N-(trimethyl-λ4-sulfanyl)acetamide?
The canonical SMILES for N-(1H-imidazol-5-ylmethyl)-N-(trimethyl-λ4-sulfanyl)acetamide is CC(=O)N(Cc1cnc[nH]1)S(C)(C)C.
What is the InChIKey of N-(1H-imidazol-5-ylmethyl)-N-(trimethyl-λ4-sulfanyl)acetamide?
The InChIKey is LLGJUKFSTUMOQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3OS/c1-8(13)12(14(2,3)4)6-9-5-10-7-11-9/h5,7H,6H2,1-4H3,(H,10,11).
What are the key properties of N-(1H-imidazol-5-ylmethyl)-N-(trimethyl-λ4-sulfanyl)acetamide?
N-(1H-imidazol-5-ylmethyl)-N-(trimethyl-λ4-sulfanyl)acetamide has a molecular weight of 215.32 g/mol, XLogP of 1.37, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-imidazol-5-ylmethyl)-N-(trimethyl-λ4-sulfanyl)acetamide is sourced from PubChem (CID 171517726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).