C10H23NO — CID 171517742
ethane;(2R,3R)-3-methyl-4-methyliminohexan-2-ol (PubChem CID 171517742) has the molecular formula C10H23NO and a molecular weight of 173.30 g/mol. Its IUPAC name is ethane;(2R,3R)-3-methyl-4-methyliminohexan-2-ol.
| Compound Name | ethane;(2R,3R)-3-methyl-4-methyliminohexan-2-ol |
|---|---|
| PubChem CID | 171517742 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | ethane;(2R,3R)-3-methyl-4-methyliminohexan-2-ol |
| SMILES | CC.CC/C(=N\C)[C@@H](C)[C@@H](C)O |
| InChI | InChI=1S/C8H17NO.C2H6/c1-5-8(9-4)6(2)7(3)10;1-2/h6-7,10H,5H2,1-4H3;1-2H3/b9-8+;/t6-,7+;/m0./s1 |
| InChIKey | GPCXZIPUMODKSU-POXAYRFRSA-N |
| XLogP | 2.51 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|