About N,3-dimethylbut-2-en-2-amine;N,N-dimethylmethanamine
N,3-dimethylbut-2-en-2-amine;N,N-dimethylmethanamine (PubChem CID 171517799) has the molecular formula C9H22N2
and a molecular weight of 158.29 g/mol. Its IUPAC name is N,3-dimethylbut-2-en-2-amine;N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | N,3-dimethylbut-2-en-2-amine;N,N-dimethylmethanamine |
| PubChem CID | 171517799 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | N,3-dimethylbut-2-en-2-amine;N,N-dimethylmethanamine |
| SMILES | CN(C)C.CNC(C)=C(C)C |
| InChI | InChI=1S/C6H13N.C3H9N/c1-5(2)6(3)7-4;1-4(2)3/h7H,1-4H3;1-3H3 |
| InChIKey | SOJCPIGQLXSDCV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,3-dimethylbut-2-en-2-amine;N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethylbut-2-en-2-amine;N,N-dimethylmethanamine?
The IUPAC name of N,3-dimethylbut-2-en-2-amine;N,N-dimethylmethanamine (CID 171517799) is N,3-dimethylbut-2-en-2-amine;N,N-dimethylmethanamine.
What is the SMILES notation for N,3-dimethylbut-2-en-2-amine;N,N-dimethylmethanamine?
The canonical SMILES for N,3-dimethylbut-2-en-2-amine;N,N-dimethylmethanamine is CN(C)C.CNC(C)=C(C)C.
What is the InChIKey of N,3-dimethylbut-2-en-2-amine;N,N-dimethylmethanamine?
The InChIKey is SOJCPIGQLXSDCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C3H9N/c1-5(2)6(3)7-4;1-4(2)3/h7H,1-4H3;1-3H3.
What are the key properties of N,3-dimethylbut-2-en-2-amine;N,N-dimethylmethanamine?
N,3-dimethylbut-2-en-2-amine;N,N-dimethylmethanamine has a molecular weight of 158.29 g/mol, XLogP of 1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethylbut-2-en-2-amine;N,N-dimethylmethanamine is sourced from PubChem (CID 171517799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).