About 1-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]-3-methylurea
1-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]-3-methylurea (PubChem CID 171517843) has the molecular formula C15H15FN4O3
and a molecular weight of 318.31 g/mol. Its IUPAC name is 1-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]-3-methylurea.
Molecular Properties
| Compound Name | 1-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]-3-methylurea |
| PubChem CID | 171517843 |
| Molecular Formula | C15H15FN4O3 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 1-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]-3-methylurea |
| SMILES | CNC(=O)NCc1cc2cc(F)c(OCc3ccon3)cc2[nH]1 |
| InChI | InChI=1S/C15H15FN4O3/c1-17-15(21)18-7-11-4-9-5-12(16)14(6-13(9)19-11)22-8-10-2-3-23-20-10/h2-6,19H,7-8H2,1H3,(H2,17,18,21) |
| InChIKey | FEEQMPRLOMZHQH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]-3-methylurea?
The IUPAC name of 1-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]-3-methylurea (CID 171517843) is 1-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]-3-methylurea.
What is the SMILES notation for 1-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]-3-methylurea?
The canonical SMILES for 1-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]-3-methylurea is CNC(=O)NCc1cc2cc(F)c(OCc3ccon3)cc2[nH]1.
What is the InChIKey of 1-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]-3-methylurea?
The InChIKey is FEEQMPRLOMZHQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15FN4O3/c1-17-15(21)18-7-11-4-9-5-12(16)14(6-13(9)19-11)22-8-10-2-3-23-20-10/h2-6,19H,7-8H2,1H3,(H2,17,18,21).
What are the key properties of 1-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]-3-methylurea?
1-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]-3-methylurea has a molecular weight of 318.31 g/mol, XLogP of 2.30, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]-3-methylurea is sourced from PubChem (CID 171517843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).