About tert-butyl N-[[6-(1,2-oxazol-3-ylmethoxy)-5-(trifluoromethoxy)-1H-indol-2-yl]methyl]carbamate
tert-butyl N-[[6-(1,2-oxazol-3-ylmethoxy)-5-(trifluoromethoxy)-1H-indol-2-yl]methyl]carbamate (PubChem CID 171517958) has the molecular formula C19H20F3N3O5
and a molecular weight of 427.38 g/mol. Its IUPAC name is tert-butyl N-[[6-(1,2-oxazol-3-ylmethoxy)-5-(trifluoromethoxy)-1H-indol-2-yl]methyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[6-(1,2-oxazol-3-ylmethoxy)-5-(trifluoromethoxy)-1H-indol-2-yl]methyl]carbamate |
| PubChem CID | 171517958 |
| Molecular Formula | C19H20F3N3O5 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | tert-butyl N-[[6-(1,2-oxazol-3-ylmethoxy)-5-(trifluoromethoxy)-1H-indol-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc2cc(OC(F)(F)F)c(OCc3ccon3)cc2[nH]1 |
| InChI | InChI=1S/C19H20F3N3O5/c1-18(2,3)30-17(26)23-9-13-6-11-7-16(29-19(20,21)22)15(8-14(11)24-13)27-10-12-4-5-28-25-12/h4-8,24H,9-10H2,1-3H3,(H,23,26) |
| InChIKey | AUIPPCVHRHLYCS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[[6-(1,2-oxazol-3-ylmethoxy)-5-(trifluoromethoxy)-1H-indol-2-yl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[6-(1,2-oxazol-3-ylmethoxy)-5-(trifluoromethoxy)-1H-indol-2-yl]methyl]carbamate?
The IUPAC name of tert-butyl N-[[6-(1,2-oxazol-3-ylmethoxy)-5-(trifluoromethoxy)-1H-indol-2-yl]methyl]carbamate (CID 171517958) is tert-butyl N-[[6-(1,2-oxazol-3-ylmethoxy)-5-(trifluoromethoxy)-1H-indol-2-yl]methyl]carbamate.
What is the SMILES notation for tert-butyl N-[[6-(1,2-oxazol-3-ylmethoxy)-5-(trifluoromethoxy)-1H-indol-2-yl]methyl]carbamate?
The canonical SMILES for tert-butyl N-[[6-(1,2-oxazol-3-ylmethoxy)-5-(trifluoromethoxy)-1H-indol-2-yl]methyl]carbamate is CC(C)(C)OC(=O)NCc1cc2cc(OC(F)(F)F)c(OCc3ccon3)cc2[nH]1.
What is the InChIKey of tert-butyl N-[[6-(1,2-oxazol-3-ylmethoxy)-5-(trifluoromethoxy)-1H-indol-2-yl]methyl]carbamate?
The InChIKey is AUIPPCVHRHLYCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F3N3O5/c1-18(2,3)30-17(26)23-9-13-6-11-7-16(29-19(20,21)22)15(8-14(11)24-13)27-10-12-4-5-28-25-12/h4-8,24H,9-10H2,1-3H3,(H,23,26).
What are the key properties of tert-butyl N-[[6-(1,2-oxazol-3-ylmethoxy)-5-(trifluoromethoxy)-1H-indol-2-yl]methyl]carbamate?
tert-butyl N-[[6-(1,2-oxazol-3-ylmethoxy)-5-(trifluoromethoxy)-1H-indol-2-yl]methyl]carbamate has a molecular weight of 427.38 g/mol, XLogP of 4.66, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[6-(1,2-oxazol-3-ylmethoxy)-5-(trifluoromethoxy)-1H-indol-2-yl]methyl]carbamate is sourced from PubChem (CID 171517958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).