About N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]propanamide
N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]propanamide (PubChem CID 171518238) has the molecular formula C16H16FN3O3
and a molecular weight of 317.32 g/mol. Its IUPAC name is N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]propanamide.
Molecular Properties
| Compound Name | N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]propanamide |
| PubChem CID | 171518238 |
| Molecular Formula | C16H16FN3O3 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]propanamide |
| SMILES | CCC(=O)NCc1cc2cc(F)c(OCc3ccon3)cc2[nH]1 |
| InChI | InChI=1S/C16H16FN3O3/c1-2-16(21)18-8-12-5-10-6-13(17)15(7-14(10)19-12)22-9-11-3-4-23-20-11/h3-7,19H,2,8-9H2,1H3,(H,18,21) |
| InChIKey | WZBXNRQVRXPRCC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]propanamide?
The IUPAC name of N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]propanamide (CID 171518238) is N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]propanamide.
What is the SMILES notation for N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]propanamide?
The canonical SMILES for N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]propanamide is CCC(=O)NCc1cc2cc(F)c(OCc3ccon3)cc2[nH]1.
What is the InChIKey of N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]propanamide?
The InChIKey is WZBXNRQVRXPRCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FN3O3/c1-2-16(21)18-8-12-5-10-6-13(17)15(7-14(10)19-12)22-9-11-3-4-23-20-11/h3-7,19H,2,8-9H2,1H3,(H,18,21).
What are the key properties of N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]propanamide?
N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]propanamide has a molecular weight of 317.32 g/mol, XLogP of 2.90, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-fluoro-6-(1,2-oxazol-3-ylmethoxy)-1H-indol-2-yl]methyl]propanamide is sourced from PubChem (CID 171518238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).