C19H27ClN2O2 — CID 171519595
N-[(5-chloro-6-methyl-1H-indol-2-yl)methyl]-2-ethyloxolane-2-carboxamide;ethane (PubChem CID 171519595) has the molecular formula C19H27ClN2O2 and a molecular weight of 350.89 g/mol. Its IUPAC name is N-[(5-chloro-6-methyl-1H-indol-2-yl)methyl]-2-ethyloxolane-2-carboxamide;ethane.
| Compound Name | N-[(5-chloro-6-methyl-1H-indol-2-yl)methyl]-2-ethyloxolane-2-carboxamide;ethane |
|---|---|
| PubChem CID | 171519595 |
| Molecular Formula | C19H27ClN2O2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | N-[(5-chloro-6-methyl-1H-indol-2-yl)methyl]-2-ethyloxolane-2-carboxamide;ethane |
| SMILES | CC.CCC1(C(=O)NCc2cc3cc(Cl)c(C)cc3[nH]2)CCCO1 |
| InChI | InChI=1S/C17H21ClN2O2.C2H6/c1-3-17(5-4-6-22-17)16(21)19-10-13-8-12-9-14(18)11(2)7-15(12)20-13;1-2/h7-9,20H,3-6,10H2,1-2H3,(H,19,21);1-2H3 |
| InChIKey | FYDJTEVWYQFAJB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |