About 1-[(5-chloro-6-propan-2-yl-1H-indol-2-yl)methyl]-3-(2,2-difluoroethyl)urea
1-[(5-chloro-6-propan-2-yl-1H-indol-2-yl)methyl]-3-(2,2-difluoroethyl)urea (PubChem CID 171519675) has the molecular formula C15H18ClF2N3O
and a molecular weight of 329.78 g/mol. Its IUPAC name is 1-[(5-chloro-6-propan-2-yl-1H-indol-2-yl)methyl]-3-(2,2-difluoroethyl)urea.
Molecular Properties
| Compound Name | 1-[(5-chloro-6-propan-2-yl-1H-indol-2-yl)methyl]-3-(2,2-difluoroethyl)urea |
| PubChem CID | 171519675 |
| Molecular Formula | C15H18ClF2N3O |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 1-[(5-chloro-6-propan-2-yl-1H-indol-2-yl)methyl]-3-(2,2-difluoroethyl)urea |
| SMILES | CC(C)c1cc2[nH]c(CNC(=O)NCC(F)F)cc2cc1Cl |
| InChI | InChI=1S/C15H18ClF2N3O/c1-8(2)11-5-13-9(4-12(11)16)3-10(21-13)6-19-15(22)20-7-14(17)18/h3-5,8,14,21H,6-7H2,1-2H3,(H2,19,20,22) |
| InChIKey | SBHSVWMNNMFTOK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(5-chloro-6-propan-2-yl-1H-indol-2-yl)methyl]-3-(2,2-difluoroethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-chloro-6-propan-2-yl-1H-indol-2-yl)methyl]-3-(2,2-difluoroethyl)urea?
The IUPAC name of 1-[(5-chloro-6-propan-2-yl-1H-indol-2-yl)methyl]-3-(2,2-difluoroethyl)urea (CID 171519675) is 1-[(5-chloro-6-propan-2-yl-1H-indol-2-yl)methyl]-3-(2,2-difluoroethyl)urea.
What is the SMILES notation for 1-[(5-chloro-6-propan-2-yl-1H-indol-2-yl)methyl]-3-(2,2-difluoroethyl)urea?
The canonical SMILES for 1-[(5-chloro-6-propan-2-yl-1H-indol-2-yl)methyl]-3-(2,2-difluoroethyl)urea is CC(C)c1cc2[nH]c(CNC(=O)NCC(F)F)cc2cc1Cl.
What is the InChIKey of 1-[(5-chloro-6-propan-2-yl-1H-indol-2-yl)methyl]-3-(2,2-difluoroethyl)urea?
The InChIKey is SBHSVWMNNMFTOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClF2N3O/c1-8(2)11-5-13-9(4-12(11)16)3-10(21-13)6-19-15(22)20-7-14(17)18/h3-5,8,14,21H,6-7H2,1-2H3,(H2,19,20,22).
What are the key properties of 1-[(5-chloro-6-propan-2-yl-1H-indol-2-yl)methyl]-3-(2,2-difluoroethyl)urea?
1-[(5-chloro-6-propan-2-yl-1H-indol-2-yl)methyl]-3-(2,2-difluoroethyl)urea has a molecular weight of 329.78 g/mol, XLogP of 4.01, 5 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-chloro-6-propan-2-yl-1H-indol-2-yl)methyl]-3-(2,2-difluoroethyl)urea is sourced from PubChem (CID 171519675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).