About 3-[2-[(4-cyano-4,5-dimethylhexanoyl)amino]ethyldisulfanyl]propanoyl fluoride
3-[2-[(4-cyano-4,5-dimethylhexanoyl)amino]ethyldisulfanyl]propanoyl fluoride (PubChem CID 171520126) has the molecular formula C14H23FN2O2S2
and a molecular weight of 334.48 g/mol. Its IUPAC name is 3-[2-[(4-cyano-4,5-dimethylhexanoyl)amino]ethyldisulfanyl]propanoyl fluoride.
Molecular Properties
| Compound Name | 3-[2-[(4-cyano-4,5-dimethylhexanoyl)amino]ethyldisulfanyl]propanoyl fluoride |
| PubChem CID | 171520126 |
| Molecular Formula | C14H23FN2O2S2 |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 3-[2-[(4-cyano-4,5-dimethylhexanoyl)amino]ethyldisulfanyl]propanoyl fluoride |
| SMILES | CC(C)C(C)(C#N)CCC(=O)NCCSSCCC(=O)F |
| InChI | InChI=1S/C14H23FN2O2S2/c1-11(2)14(3,10-16)6-4-13(19)17-7-9-21-20-8-5-12(15)18/h11H,4-9H2,1-3H3,(H,17,19) |
| InChIKey | GMCSIEZLLIABMD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[(4-cyano-4,5-dimethylhexanoyl)amino]ethyldisulfanyl]propanoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(4-cyano-4,5-dimethylhexanoyl)amino]ethyldisulfanyl]propanoyl fluoride?
The IUPAC name of 3-[2-[(4-cyano-4,5-dimethylhexanoyl)amino]ethyldisulfanyl]propanoyl fluoride (CID 171520126) is 3-[2-[(4-cyano-4,5-dimethylhexanoyl)amino]ethyldisulfanyl]propanoyl fluoride.
What is the SMILES notation for 3-[2-[(4-cyano-4,5-dimethylhexanoyl)amino]ethyldisulfanyl]propanoyl fluoride?
The canonical SMILES for 3-[2-[(4-cyano-4,5-dimethylhexanoyl)amino]ethyldisulfanyl]propanoyl fluoride is CC(C)C(C)(C#N)CCC(=O)NCCSSCCC(=O)F.
What is the InChIKey of 3-[2-[(4-cyano-4,5-dimethylhexanoyl)amino]ethyldisulfanyl]propanoyl fluoride?
The InChIKey is GMCSIEZLLIABMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23FN2O2S2/c1-11(2)14(3,10-16)6-4-13(19)17-7-9-21-20-8-5-12(15)18/h11H,4-9H2,1-3H3,(H,17,19).
What are the key properties of 3-[2-[(4-cyano-4,5-dimethylhexanoyl)amino]ethyldisulfanyl]propanoyl fluoride?
3-[2-[(4-cyano-4,5-dimethylhexanoyl)amino]ethyldisulfanyl]propanoyl fluoride has a molecular weight of 334.48 g/mol, XLogP of 3.34, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(4-cyano-4,5-dimethylhexanoyl)amino]ethyldisulfanyl]propanoyl fluoride is sourced from PubChem (CID 171520126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).