About 2-(1,3-dihydroisoindol-2-yl)-9-(1-ethoxyethenyl)-7-methylpyrido[1,2-a]pyrimidin-4-one
2-(1,3-dihydroisoindol-2-yl)-9-(1-ethoxyethenyl)-7-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 171520368) has the molecular formula C21H21N3O2
and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-(1,3-dihydroisoindol-2-yl)-9-(1-ethoxyethenyl)-7-methylpyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-(1,3-dihydroisoindol-2-yl)-9-(1-ethoxyethenyl)-7-methylpyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 171520368 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-(1,3-dihydroisoindol-2-yl)-9-(1-ethoxyethenyl)-7-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | C=C(OCC)c1cc(C)cn2c(=O)cc(N3Cc4ccccc4C3)nc12 |
| InChI | InChI=1S/C21H21N3O2/c1-4-26-15(3)18-9-14(2)11-24-20(25)10-19(22-21(18)24)23-12-16-7-5-6-8-17(16)13-23/h5-11H,3-4,12-13H2,1-2H3 |
| InChIKey | WFZBRZHPELSMNE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dihydroisoindol-2-yl)-9-(1-ethoxyethenyl)-7-methylpyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dihydroisoindol-2-yl)-9-(1-ethoxyethenyl)-7-methylpyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 2-(1,3-dihydroisoindol-2-yl)-9-(1-ethoxyethenyl)-7-methylpyrido[1,2-a]pyrimidin-4-one (CID 171520368) is 2-(1,3-dihydroisoindol-2-yl)-9-(1-ethoxyethenyl)-7-methylpyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 2-(1,3-dihydroisoindol-2-yl)-9-(1-ethoxyethenyl)-7-methylpyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 2-(1,3-dihydroisoindol-2-yl)-9-(1-ethoxyethenyl)-7-methylpyrido[1,2-a]pyrimidin-4-one is C=C(OCC)c1cc(C)cn2c(=O)cc(N3Cc4ccccc4C3)nc12.
What is the InChIKey of 2-(1,3-dihydroisoindol-2-yl)-9-(1-ethoxyethenyl)-7-methylpyrido[1,2-a]pyrimidin-4-one?
The InChIKey is WFZBRZHPELSMNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O2/c1-4-26-15(3)18-9-14(2)11-24-20(25)10-19(22-21(18)24)23-12-16-7-5-6-8-17(16)13-23/h5-11H,3-4,12-13H2,1-2H3.
What are the key properties of 2-(1,3-dihydroisoindol-2-yl)-9-(1-ethoxyethenyl)-7-methylpyrido[1,2-a]pyrimidin-4-one?
2-(1,3-dihydroisoindol-2-yl)-9-(1-ethoxyethenyl)-7-methylpyrido[1,2-a]pyrimidin-4-one has a molecular weight of 347.42 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dihydroisoindol-2-yl)-9-(1-ethoxyethenyl)-7-methylpyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 171520368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).