C23H45NO — CID 171520786
(E,3Z)-4-[(Z)-but-2-en-2-yl]-N,N-dimethyl-3-propylidenehept-4-en-1-amine;ethane;2-ethoxyprop-1-ene (PubChem CID 171520786) has the molecular formula C23H45NO and a molecular weight of 351.62 g/mol. Its IUPAC name is (E,3Z)-4-[(Z)-but-2-en-2-yl]-N,N-dimethyl-3-propylidenehept-4-en-1-amine;ethane;2-ethoxyprop-1-ene.
| Compound Name | (E,3Z)-4-[(Z)-but-2-en-2-yl]-N,N-dimethyl-3-propylidenehept-4-en-1-amine;ethane;2-ethoxyprop-1-ene |
|---|---|
| PubChem CID | 171520786 |
| Molecular Formula | C23H45NO |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 351.35 |
| IUPAC Name | (E,3Z)-4-[(Z)-but-2-en-2-yl]-N,N-dimethyl-3-propylidenehept-4-en-1-amine;ethane;2-ethoxyprop-1-ene |
| SMILES | C/C=C(C)\C(=C/CC)C(=C/CC)\CCN(C)C.C=C(C)OCC.CC |
| InChI | InChI=1S/C16H29N.C5H10O.C2H6/c1-7-10-15(12-13-17(5)6)16(11-8-2)14(4)9-3;1-4-6-5(2)3;1-2/h9-11H,7-8,12-13H2,1-6H3;2,4H2,1,3H3;1-2H3/b14-9-,15-10-,16-11+;; |
| InChIKey | TWEAXSQVZNDWSC-UVCVHWKOSA-N |
| XLogP | 7.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|