C11H10FN3O — CID 171520973
7-ethenyl-3-ethyl-8-fluoro-1H-pyrido[3,4-b]pyrazin-2-one (PubChem CID 171520973) has the molecular formula C11H10FN3O and a molecular weight of 219.22 g/mol. Its IUPAC name is 7-ethenyl-3-ethyl-8-fluoro-1H-pyrido[3,4-b]pyrazin-2-one.
| Compound Name | 7-ethenyl-3-ethyl-8-fluoro-1H-pyrido[3,4-b]pyrazin-2-one |
|---|---|
| PubChem CID | 171520973 |
| Molecular Formula | C11H10FN3O |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 7-ethenyl-3-ethyl-8-fluoro-1H-pyrido[3,4-b]pyrazin-2-one |
| SMILES | C=Cc1ncc2nc(CC)c(=O)[nH]c2c1F |
| InChI | InChI=1S/C11H10FN3O/c1-3-6-9(12)10-8(5-13-6)14-7(4-2)11(16)15-10/h3,5H,1,4H2,2H3,(H,15,16) |
| InChIKey | AXNBGDYNFWNLFV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |