C18H11F5N2O4 — CID 171521582
1-[2-methoxy-5-(2,3,4,5,6-pentafluorobenzoyl)phenyl]-1,3-diazinane-2,4-dione (PubChem CID 171521582) has the molecular formula C18H11F5N2O4 and a molecular weight of 414.29 g/mol. Its IUPAC name is 1-[2-methoxy-5-(2,3,4,5,6-pentafluorobenzoyl)phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[2-methoxy-5-(2,3,4,5,6-pentafluorobenzoyl)phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 171521582 |
| Molecular Formula | C18H11F5N2O4 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 1-[2-methoxy-5-(2,3,4,5,6-pentafluorobenzoyl)phenyl]-1,3-diazinane-2,4-dione |
| SMILES | COc1ccc(C(=O)c2c(F)c(F)c(F)c(F)c2F)cc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H11F5N2O4/c1-29-9-3-2-7(6-8(9)25-5-4-10(26)24-18(25)28)17(27)11-12(19)14(21)16(23)15(22)13(11)20/h2-3,6H,4-5H2,1H3,(H,24,26,28) |
| InChIKey | CNDHSBUXYSIZTI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|