About 7-chloro-4-methyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one
7-chloro-4-methyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one (PubChem CID 171521616) has the molecular formula C7H6ClN3O
and a molecular weight of 183.60 g/mol. Its IUPAC name is 7-chloro-4-methyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one.
Molecular Properties
| Compound Name | 7-chloro-4-methyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one |
| PubChem CID | 171521616 |
| Molecular Formula | C7H6ClN3O |
| Molecular Weight | 183.60 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 7-chloro-4-methyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one |
| SMILES | Cc1n[nH]c(=O)c2c(Cl)[nH]cc12 |
| InChI | InChI=1S/C7H6ClN3O/c1-3-4-2-9-6(8)5(4)7(12)11-10-3/h2,9H,1H3,(H,11,12) |
| InChIKey | VWNKQDOFURSSSZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.60 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-4-methyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4-methyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one?
The IUPAC name of 7-chloro-4-methyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one (CID 171521616) is 7-chloro-4-methyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one.
What is the SMILES notation for 7-chloro-4-methyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one?
The canonical SMILES for 7-chloro-4-methyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one is Cc1n[nH]c(=O)c2c(Cl)[nH]cc12.
What is the InChIKey of 7-chloro-4-methyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one?
The InChIKey is VWNKQDOFURSSSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3O/c1-3-4-2-9-6(8)5(4)7(12)11-10-3/h2,9H,1H3,(H,11,12).
What are the key properties of 7-chloro-4-methyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one?
7-chloro-4-methyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one has a molecular weight of 183.60 g/mol, XLogP of 1.21, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4-methyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one is sourced from PubChem (CID 171521616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).