About (4-nitrocyclohexa-1,3-dien-1-yl)methanol
(4-nitrocyclohexa-1,3-dien-1-yl)methanol (PubChem CID 171521751) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is (4-nitrocyclohexa-1,3-dien-1-yl)methanol.
Molecular Properties
| Compound Name | (4-nitrocyclohexa-1,3-dien-1-yl)methanol |
| PubChem CID | 171521751 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | (4-nitrocyclohexa-1,3-dien-1-yl)methanol |
| SMILES | O=[N+]([O-])C1=CC=C(CO)CC1 |
| InChI | InChI=1S/C7H9NO3/c9-5-6-1-3-7(4-2-6)8(10)11/h1,3,9H,2,4-5H2 |
| InChIKey | OPQOERLJAAIFBA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrocyclohexa-1,3-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrocyclohexa-1,3-dien-1-yl)methanol?
The IUPAC name of (4-nitrocyclohexa-1,3-dien-1-yl)methanol (CID 171521751) is (4-nitrocyclohexa-1,3-dien-1-yl)methanol.
What is the SMILES notation for (4-nitrocyclohexa-1,3-dien-1-yl)methanol?
The canonical SMILES for (4-nitrocyclohexa-1,3-dien-1-yl)methanol is O=[N+]([O-])C1=CC=C(CO)CC1.
What is the InChIKey of (4-nitrocyclohexa-1,3-dien-1-yl)methanol?
The InChIKey is OPQOERLJAAIFBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3/c9-5-6-1-3-7(4-2-6)8(10)11/h1,3,9H,2,4-5H2.
What are the key properties of (4-nitrocyclohexa-1,3-dien-1-yl)methanol?
(4-nitrocyclohexa-1,3-dien-1-yl)methanol has a molecular weight of 155.15 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrocyclohexa-1,3-dien-1-yl)methanol is sourced from PubChem (CID 171521751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).