C21H32N2O2 — CID 171522133
1,3-dimethoxybenzene;ethane;1-methyl-4-phenylpiperazine (PubChem CID 171522133) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 1,3-dimethoxybenzene;ethane;1-methyl-4-phenylpiperazine.
| Compound Name | 1,3-dimethoxybenzene;ethane;1-methyl-4-phenylpiperazine |
|---|---|
| PubChem CID | 171522133 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 1,3-dimethoxybenzene;ethane;1-methyl-4-phenylpiperazine |
| SMILES | CC.CN1CCN(c2ccccc2)CC1.COc1cccc(OC)c1 |
| InChI | InChI=1S/C11H16N2.C8H10O2.C2H6/c1-12-7-9-13(10-8-12)11-5-3-2-4-6-11;1-9-7-4-3-5-8(6-7)10-2;1-2/h2-6H,7-10H2,1H3;3-6H,1-2H3;1-2H3 |
| InChIKey | JCYVXRDGONQEGA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |