C22H25INO- — CID 171522843
CID 171522843 (PubChem CID 171522843) has the molecular formula C22H25INO- and a molecular weight of 446.35 g/mol.
| Compound Name | CID 171522843 |
|---|---|
| PubChem CID | 171522843 |
| Molecular Formula | C22H25INO- |
| Molecular Weight | 446.35 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | — |
| SMILES | Cc1cc(C2=C[I-]C3(CCCC3)Oc3ccccc32)cnc1C(C)C |
| InChI | InChI=1S/C22H25INO/c1-15(2)21-16(3)12-17(14-24-21)19-13-23-22(10-6-7-11-22)25-20-9-5-4-8-18(19)20/h4-5,8-9,12-15H,6-7,10-11H2,1-3H3/q-1 |
| InChIKey | XASRJAXAZRSDNK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|