C17H27NO — CID 171522896
ethane;methane;1-(3-methylphenyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-2-one (PubChem CID 171522896) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is ethane;methane;1-(3-methylphenyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-2-one.
| Compound Name | ethane;methane;1-(3-methylphenyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-2-one |
|---|---|
| PubChem CID | 171522896 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | ethane;methane;1-(3-methylphenyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-2-one |
| SMILES | C.CC.Cc1cccc(N2C(=O)CC3CCCC32)c1 |
| InChI | InChI=1S/C14H17NO.C2H6.CH4/c1-10-4-2-6-12(8-10)15-13-7-3-5-11(13)9-14(15)16;1-2;/h2,4,6,8,11,13H,3,5,7,9H2,1H3;1-2H3;1H4 |
| InChIKey | DXFKFIIAICOQEG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |