C26H26ClN5O2 — CID 171523383
1-(3-chlorophenyl)-N-(cyclopropylmethyl)-7-oxo-6-(1,2,3,4-tetrahydroisoquinolin-7-yl)-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide (PubChem CID 171523383) has the molecular formula C26H26ClN5O2 and a molecular weight of 475.98 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-(cyclopropylmethyl)-7-oxo-6-(1,2,3,4-tetrahydroisoquinolin-7-yl)-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-(cyclopropylmethyl)-7-oxo-6-(1,2,3,4-tetrahydroisoquinolin-7-yl)-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171523383 |
| Molecular Formula | C26H26ClN5O2 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 1-(3-chlorophenyl)-N-(cyclopropylmethyl)-7-oxo-6-(1,2,3,4-tetrahydroisoquinolin-7-yl)-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide |
| SMILES | O=C(NCC1CC1)c1nn(-c2cccc(Cl)c2)c2c1CCN(c1ccc3c(c1)CNCC3)C2=O |
| InChI | InChI=1S/C26H26ClN5O2/c27-19-2-1-3-21(13-19)32-24-22(23(30-32)25(33)29-14-16-4-5-16)9-11-31(26(24)34)20-7-6-17-8-10-28-15-18(17)12-20/h1-3,6-7,12-13,16,28H,4-5,8-11,14-15H2,(H,29,33) |
| InChIKey | FLIWGLVGZNBQRK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |