About 3-[(3R)-5,5-difluoro-1-(imidazole-1-carbonyl)piperidin-3-yl]-1,3-oxazinan-2-one
3-[(3R)-5,5-difluoro-1-(imidazole-1-carbonyl)piperidin-3-yl]-1,3-oxazinan-2-one (PubChem CID 171523810) has the molecular formula C13H16F2N4O3
and a molecular weight of 314.29 g/mol. Its IUPAC name is 3-[(3R)-5,5-difluoro-1-(imidazole-1-carbonyl)piperidin-3-yl]-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | 3-[(3R)-5,5-difluoro-1-(imidazole-1-carbonyl)piperidin-3-yl]-1,3-oxazinan-2-one |
| PubChem CID | 171523810 |
| Molecular Formula | C13H16F2N4O3 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 3-[(3R)-5,5-difluoro-1-(imidazole-1-carbonyl)piperidin-3-yl]-1,3-oxazinan-2-one |
| SMILES | O=C1OCCCN1[C@H]1CN(C(=O)n2ccnc2)CC(F)(F)C1 |
| InChI | InChI=1S/C13H16F2N4O3/c14-13(15)6-10(19-3-1-5-22-12(19)21)7-18(8-13)11(20)17-4-2-16-9-17/h2,4,9-10H,1,3,5-8H2/t10-/m1/s1 |
| InChIKey | RQCYGYXHMNFCGU-SNVBAGLBSA-N |
| XLogP | 1.40 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(3R)-5,5-difluoro-1-(imidazole-1-carbonyl)piperidin-3-yl]-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R)-5,5-difluoro-1-(imidazole-1-carbonyl)piperidin-3-yl]-1,3-oxazinan-2-one?
The IUPAC name of 3-[(3R)-5,5-difluoro-1-(imidazole-1-carbonyl)piperidin-3-yl]-1,3-oxazinan-2-one (CID 171523810) is 3-[(3R)-5,5-difluoro-1-(imidazole-1-carbonyl)piperidin-3-yl]-1,3-oxazinan-2-one.
What is the SMILES notation for 3-[(3R)-5,5-difluoro-1-(imidazole-1-carbonyl)piperidin-3-yl]-1,3-oxazinan-2-one?
The canonical SMILES for 3-[(3R)-5,5-difluoro-1-(imidazole-1-carbonyl)piperidin-3-yl]-1,3-oxazinan-2-one is O=C1OCCCN1[C@H]1CN(C(=O)n2ccnc2)CC(F)(F)C1.
What is the InChIKey of 3-[(3R)-5,5-difluoro-1-(imidazole-1-carbonyl)piperidin-3-yl]-1,3-oxazinan-2-one?
The InChIKey is RQCYGYXHMNFCGU-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H16F2N4O3/c14-13(15)6-10(19-3-1-5-22-12(19)21)7-18(8-13)11(20)17-4-2-16-9-17/h2,4,9-10H,1,3,5-8H2/t10-/m1/s1.
What are the key properties of 3-[(3R)-5,5-difluoro-1-(imidazole-1-carbonyl)piperidin-3-yl]-1,3-oxazinan-2-one?
3-[(3R)-5,5-difluoro-1-(imidazole-1-carbonyl)piperidin-3-yl]-1,3-oxazinan-2-one has a molecular weight of 314.29 g/mol, XLogP of 1.40, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R)-5,5-difluoro-1-(imidazole-1-carbonyl)piperidin-3-yl]-1,3-oxazinan-2-one is sourced from PubChem (CID 171523810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).