About 1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one iodide
1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one iodide (PubChem CID 171523906) has the molecular formula C14H19F2IN4O2
and a molecular weight of 440.23 g/mol. Its IUPAC name is 1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one iodide.
Molecular Properties
| Compound Name | 1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one iodide |
| PubChem CID | 171523906 |
| Molecular Formula | C14H19F2IN4O2 |
| Molecular Weight | 440.23 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one iodide |
| SMILES | C[n+]1ccn(C(=O)N2C[C@H](N3CCCC3=O)CC(F)(F)C2)c1.[I-] |
| InChI | InChI=1S/C14H19F2N4O2.HI/c1-17-5-6-18(10-17)13(22)19-8-11(7-14(15,16)9-19)20-4-2-3-12(20)21;/h5-6,10-11H,2-4,7-9H2,1H3;1H/q+1;/p-1/t11-;/m1./s1 |
| InChIKey | IFLVQGJMRWFBLV-RFVHGSKJSA-M |
| XLogP | -2.38 |
| TPSA | 49.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.23 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one iodide?
The IUPAC name of 1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one iodide (CID 171523906) is 1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one iodide.
What is the SMILES notation for 1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one iodide?
The canonical SMILES for 1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one iodide is C[n+]1ccn(C(=O)N2C[C@H](N3CCCC3=O)CC(F)(F)C2)c1.[I-].
What is the InChIKey of 1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one iodide?
The InChIKey is IFLVQGJMRWFBLV-RFVHGSKJSA-M. The full InChI is InChI=1S/C14H19F2N4O2.HI/c1-17-5-6-18(10-17)13(22)19-8-11(7-14(15,16)9-19)20-4-2-3-12(20)21;/h5-6,10-11H,2-4,7-9H2,1H3;1H/q+1;/p-1/t11-;/m1./s1.
What are the key properties of 1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one iodide?
1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one iodide has a molecular weight of 440.23 g/mol, XLogP of -2.38, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one iodide is sourced from PubChem (CID 171523906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).