C14H19F2N4O2+ — CID 171523907
1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one (PubChem CID 171523907) has the molecular formula C14H19F2N4O2+ and a molecular weight of 313.33 g/mol. Its IUPAC name is 1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one.
| Compound Name | 1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 171523907 |
| Molecular Formula | C14H19F2N4O2+ |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-[(3R)-5,5-difluoro-1-(3-methylimidazol-3-ium-1-carbonyl)piperidin-3-yl]pyrrolidin-2-one |
| SMILES | C[n+]1ccn(C(=O)N2C[C@H](N3CCCC3=O)CC(F)(F)C2)c1 |
| InChI | InChI=1S/C14H19F2N4O2/c1-17-5-6-18(10-17)13(22)19-8-11(7-14(15,16)9-19)20-4-2-3-12(20)21/h5-6,10-11H,2-4,7-9H2,1H3/q+1/t11-/m1/s1 |
| InChIKey | RRXGMRXKNAASHV-LLVKDONJSA-N |
| XLogP | 0.61 |
| TPSA | 49.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|